C42H42O7 — CID 70872926
(2S,3R,4R,5S,6R)-2-[3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-4-ethylphenyl]-6-(trityloxymethyl)oxane-3,4,5-triol (PubChem CID 70872926) has the molecular formula C42H42O7 and a molecular weight of 658.79 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-4-ethylphenyl]-6-(trityloxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-4-ethylphenyl]-6-(trityloxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 70872926 |
| Molecular Formula | C42H42O7 |
| Molecular Weight | 658.79 g/mol |
| Exact Mass | 658.29 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-4-ethylphenyl]-6-(trityloxymethyl)oxane-3,4,5-triol |
| SMILES | CCc1ccc([C@@H]2O[C@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)[C@@H](O)[C@H](O)[C@H]2O)cc1Cc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C42H42O7/c1-2-29-19-20-30(26-31(29)24-28-18-21-35-36(25-28)47-23-22-46-35)41-40(45)39(44)38(43)37(49-41)27-48-42(32-12-6-3-7-13-32,33-14-8-4-9-15-33)34-16-10-5-11-17-34/h3-21,25-26,37-41,43-45H,2,22-24,27H2,1H3/t37-,38-,39+,40-,41+/m1/s1 |
| InChIKey | NMZPBFPNBWDYIL-WEOXEBIHSA-N |
| XLogP | 6.14 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.79 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|