C28H30O7 — CID 71502482
(2S,3R,4R,5S,6R)-2-[3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-2-methyl-5-phenylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 71502482) has the molecular formula C28H30O7 and a molecular weight of 478.54 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-2-methyl-5-phenylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-2-methyl-5-phenylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 71502482 |
| Molecular Formula | C28H30O7 |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-2-methyl-5-phenylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Cc1c(Cc2ccc3c(c2)OCCO3)cc(-c2ccccc2)cc1[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C28H30O7/c1-16-19(11-17-7-8-22-23(12-17)34-10-9-33-22)13-20(18-5-3-2-4-6-18)14-21(16)28-27(32)26(31)25(30)24(15-29)35-28/h2-8,12-14,24-32H,9-11,15H2,1H3/t24-,25-,26+,27-,28+/m1/s1 |
| InChIKey | AMRJNQYXTHAFOH-DFLSAPQXSA-N |
| XLogP | 2.54 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |