C27H31BrO7 — CID 58340777
[(2R,3S,4S,5R,6S)-5-acetyloxy-6-[4-bromo-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)phenyl]-2-ethyl-4-methyloxan-3-yl] acetate (PubChem CID 58340777) has the molecular formula C27H31BrO7 and a molecular weight of 547.44 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-5-acetyloxy-6-[4-bromo-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)phenyl]-2-ethyl-4-methyloxan-3-yl] acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-5-acetyloxy-6-[4-bromo-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)phenyl]-2-ethyl-4-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 58340777 |
| Molecular Formula | C27H31BrO7 |
| Molecular Weight | 547.44 g/mol |
| Exact Mass | 546.13 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-5-acetyloxy-6-[4-bromo-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)phenyl]-2-ethyl-4-methyloxan-3-yl] acetate |
| SMILES | CC[C@H]1O[C@@H](c2ccc(Br)c(Cc3ccc4c(c3)OCCO4)c2)[C@H](OC(C)=O)[C@@H](C)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H31BrO7/c1-5-22-25(33-16(3)29)15(2)26(34-17(4)30)27(35-22)19-7-8-21(28)20(14-19)12-18-6-9-23-24(13-18)32-11-10-31-23/h6-9,13-15,22,25-27H,5,10-12H2,1-4H3/t15-,22+,25-,26+,27-/m0/s1 |
| InChIKey | ASNUNNMNDLTVFE-XKMNSAFGSA-N |
| XLogP | 5.16 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.44 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |