C39H42O7 — CID 122451115
(2S,3S,4S,5R)-6-[3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-4-ethylphenyl]-6-methoxy-3-methyl-4,5-bis(phenylmethoxy)oxane-2-carbaldehyde (PubChem CID 122451115) has the molecular formula C39H42O7 and a molecular weight of 622.76 g/mol. Its IUPAC name is (2S,3S,4S,5R)-6-[3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-4-ethylphenyl]-6-methoxy-3-methyl-4,5-bis(phenylmethoxy)oxane-2-carbaldehyde.
| Compound Name | (2S,3S,4S,5R)-6-[3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-4-ethylphenyl]-6-methoxy-3-methyl-4,5-bis(phenylmethoxy)oxane-2-carbaldehyde |
|---|---|
| PubChem CID | 122451115 |
| Molecular Formula | C39H42O7 |
| Molecular Weight | 622.76 g/mol |
| Exact Mass | 622.29 |
| IUPAC Name | (2S,3S,4S,5R)-6-[3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-4-ethylphenyl]-6-methoxy-3-methyl-4,5-bis(phenylmethoxy)oxane-2-carbaldehyde |
| SMILES | CCc1ccc(C2(OC)O[C@H](C=O)[C@@H](C)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)cc1Cc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C39H42O7/c1-4-31-16-17-33(23-32(31)21-30-15-18-34-35(22-30)43-20-19-42-34)39(41-3)38(45-26-29-13-9-6-10-14-29)37(27(2)36(24-40)46-39)44-25-28-11-7-5-8-12-28/h5-18,22-24,27,36-38H,4,19-21,25-26H2,1-3H3/t27-,36-,37+,38-,39?/m1/s1 |
| InChIKey | JVLVKHXIFNLKBR-HIAREAKFSA-N |
| XLogP | 6.81 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.76 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|