C29H42O9Si — CID 159837773
(2S,3R,4S,5S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-4-methoxyphenyl]-2-methoxyoxane-3,4,5-triol (PubChem CID 159837773) has the molecular formula C29H42O9Si and a molecular weight of 562.73 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-4-methoxyphenyl]-2-methoxyoxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-4-methoxyphenyl]-2-methoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 159837773 |
| Molecular Formula | C29H42O9Si |
| Molecular Weight | 562.73 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | (2S,3R,4S,5S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-4-methoxyphenyl]-2-methoxyoxane-3,4,5-triol |
| SMILES | COc1ccc([C@]2(OC)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)cc1Cc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C29H42O9Si/c1-28(2,3)39(6,7)37-17-24-25(30)26(31)27(32)29(34-5,38-24)20-9-11-21(33-4)19(16-20)14-18-8-10-22-23(15-18)36-13-12-35-22/h8-11,15-16,24-27,30-32H,12-14,17H2,1-7H3/t24-,25-,26+,27-,29+/m1/s1 |
| InChIKey | NOHLDONITGEJLH-QLZLUGFASA-N |
| XLogP | 3.36 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.73 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|