C27H33ClO7 — CID 134331209
(3R,4S,5S,6R)-2-[4-chloro-3-[[4-[[(1R,5S)-6-methyl-3-bicyclo[3.1.0]hexanyl]oxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol (PubChem CID 134331209) has the molecular formula C27H33ClO7 and a molecular weight of 505.01 g/mol. Its IUPAC name is (3R,4S,5S,6R)-2-[4-chloro-3-[[4-[[(1R,5S)-6-methyl-3-bicyclo[3.1.0]hexanyl]oxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol.
| Compound Name | (3R,4S,5S,6R)-2-[4-chloro-3-[[4-[[(1R,5S)-6-methyl-3-bicyclo[3.1.0]hexanyl]oxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 134331209 |
| Molecular Formula | C27H33ClO7 |
| Molecular Weight | 505.01 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | (3R,4S,5S,6R)-2-[4-chloro-3-[[4-[[(1R,5S)-6-methyl-3-bicyclo[3.1.0]hexanyl]oxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol |
| SMILES | COC1(c2ccc(Cl)c(Cc3ccc(OC4C[C@@H]5C(C)[C@@H]5C4)cc3)c2)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C27H33ClO7/c1-14-20-11-19(12-21(14)20)34-18-6-3-15(4-7-18)9-16-10-17(5-8-22(16)28)27(33-2)26(32)25(31)24(30)23(13-29)35-27/h3-8,10,14,19-21,23-26,29-32H,9,11-13H2,1-2H3/t14?,19?,20-,21+,23-,24-,25+,26-,27?/m1/s1 |
| InChIKey | OZLGRLPAYVQIFI-CEINDWCCSA-N |
| XLogP | 2.63 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.01 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |