C46H47ClO9 — CID 144798098
[(2R,3S,4S,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2-formyl-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl acetate (PubChem CID 144798098) has the molecular formula C46H47ClO9 and a molecular weight of 779.33 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2-formyl-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2-formyl-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 144798098 |
| Molecular Formula | C46H47ClO9 |
| Molecular Weight | 779.33 g/mol |
| Exact Mass | 778.29 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2-formyl-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl acetate |
| SMILES | CCOc1ccc(Cc2cc([C@]3(OC)O[C@](C=O)(COC(C)=O)[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@H]3OCc3ccccc3)ccc2Cl)cc1 |
| InChI | InChI=1S/C46H47ClO9/c1-4-51-40-23-20-34(21-24-40)26-38-27-39(22-25-41(38)47)46(50-3)44(54-30-37-18-12-7-13-19-37)42(52-28-35-14-8-5-9-15-35)43(53-29-36-16-10-6-11-17-36)45(31-48,56-46)32-55-33(2)49/h5-25,27,31,42-44H,4,26,28-30,32H2,1-3H3/t42-,43-,44+,45+,46-/m0/s1 |
| InChIKey | NVMDBXYRNVKNJS-RDYGHCHPSA-N |
| XLogP | 8.42 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.33 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|