C37H55ClO8 — CID 118396443
(2R,3S,4S,5R,6S)-3,4,5-tributoxy-6-[3-[(4-butoxyphenyl)methyl]-4-chlorophenyl]-2-(hydroxymethyl)-6-methoxyoxane-2-carbaldehyde (PubChem CID 118396443) has the molecular formula C37H55ClO8 and a molecular weight of 663.29 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-3,4,5-tributoxy-6-[3-[(4-butoxyphenyl)methyl]-4-chlorophenyl]-2-(hydroxymethyl)-6-methoxyoxane-2-carbaldehyde.
| Compound Name | (2R,3S,4S,5R,6S)-3,4,5-tributoxy-6-[3-[(4-butoxyphenyl)methyl]-4-chlorophenyl]-2-(hydroxymethyl)-6-methoxyoxane-2-carbaldehyde |
|---|---|
| PubChem CID | 118396443 |
| Molecular Formula | C37H55ClO8 |
| Molecular Weight | 663.29 g/mol |
| Exact Mass | 662.36 |
| IUPAC Name | (2R,3S,4S,5R,6S)-3,4,5-tributoxy-6-[3-[(4-butoxyphenyl)methyl]-4-chlorophenyl]-2-(hydroxymethyl)-6-methoxyoxane-2-carbaldehyde |
| SMILES | CCCCOc1ccc(Cc2cc([C@]3(OC)O[C@](C=O)(CO)[C@@H](OCCCC)[C@H](OCCCC)[C@H]3OCCCC)ccc2Cl)cc1 |
| InChI | InChI=1S/C37H55ClO8/c1-6-10-20-42-31-17-14-28(15-18-31)24-29-25-30(16-19-32(29)38)37(41-5)35(45-23-13-9-4)33(43-21-11-7-2)34(44-22-12-8-3)36(26-39,27-40)46-37/h14-19,25-26,33-35,40H,6-13,20-24,27H2,1-5H3/t33-,34-,35+,36+,37-/m0/s1 |
| InChIKey | CKOSETJGDQSYLN-NSDPJUTJSA-N |
| XLogP | 7.43 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.29 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|