C44H46ClNO7 — CID 118377944
2-amino-1-[(1R,2R,3S,4R,5S)-5-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2,3,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octan-1-yl]ethanol (PubChem CID 118377944) has the molecular formula C44H46ClNO7 and a molecular weight of 736.31 g/mol. Its IUPAC name is 2-amino-1-[(1R,2R,3S,4R,5S)-5-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2,3,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octan-1-yl]ethanol.
| Compound Name | 2-amino-1-[(1R,2R,3S,4R,5S)-5-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2,3,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octan-1-yl]ethanol |
|---|---|
| PubChem CID | 118377944 |
| Molecular Formula | C44H46ClNO7 |
| Molecular Weight | 736.31 g/mol |
| Exact Mass | 735.30 |
| IUPAC Name | 2-amino-1-[(1R,2R,3S,4R,5S)-5-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2,3,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octan-1-yl]ethanol |
| SMILES | CCOc1ccc(Cc2cc([C@]34OC[C@](C(O)CN)(O3)[C@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]4OCc3ccccc3)ccc2Cl)cc1 |
| InChI | InChI=1S/C44H46ClNO7/c1-2-48-37-21-18-31(19-22-37)24-35-25-36(20-23-38(35)45)44-42(51-29-34-16-10-5-11-17-34)40(49-27-32-12-6-3-7-13-32)41(50-28-33-14-8-4-9-15-33)43(53-44,30-52-44)39(47)26-46/h3-23,25,39-42,47H,2,24,26-30,46H2,1H3/t39?,40-,41+,42+,43+,44-/m0/s1 |
| InChIKey | RFMSBTXZCQDWBM-VJFJDNAUSA-N |
| XLogP | 7.36 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.31 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |