C43H42ClNO6S — CID 89486227
2-[(2S,3S,4R,5S,6S)-6-[4-chloro-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]propan-2-ol (PubChem CID 89486227) has the molecular formula C43H42ClNO6S and a molecular weight of 736.33 g/mol. Its IUPAC name is 2-[(2S,3S,4R,5S,6S)-6-[4-chloro-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]propan-2-ol.
| Compound Name | 2-[(2S,3S,4R,5S,6S)-6-[4-chloro-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 89486227 |
| Molecular Formula | C43H42ClNO6S |
| Molecular Weight | 736.33 g/mol |
| Exact Mass | 735.24 |
| IUPAC Name | 2-[(2S,3S,4R,5S,6S)-6-[4-chloro-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]propan-2-ol |
| SMILES | CC(C)(O)[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ncc(-c4ccco4)s3)c2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C43H42ClNO6S/c1-43(2,46)42-41(50-28-31-17-10-5-11-18-31)40(49-27-30-15-8-4-9-16-30)39(48-26-29-13-6-3-7-14-29)38(51-42)32-20-21-34(44)33(23-32)24-37-45-25-36(52-37)35-19-12-22-47-35/h3-23,25,38-42,46H,24,26-28H2,1-2H3/t38-,39-,40+,41-,42-/m0/s1 |
| InChIKey | HYZRKCXDVQCUPH-SRWPCTQNSA-N |
| XLogP | 9.61 |
| TPSA | 83.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.33 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |