C36H52ClNO7S — CID 89494904
5-chloro-4-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]-2-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]phenol (PubChem CID 89494904) has the molecular formula C36H52ClNO7S and a molecular weight of 678.33 g/mol. Its IUPAC name is 5-chloro-4-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]-2-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]phenol.
| Compound Name | 5-chloro-4-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]-2-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]phenol |
|---|---|
| PubChem CID | 89494904 |
| Molecular Formula | C36H52ClNO7S |
| Molecular Weight | 678.33 g/mol |
| Exact Mass | 677.32 |
| IUPAC Name | 5-chloro-4-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]-2-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]phenol |
| SMILES | CCCCOC[C@H]1O[C@@H](c2cc(Cc3ncc(-c4ccco4)s3)c(Cl)cc2O)C(OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C36H52ClNO7S/c1-5-9-15-40-24-30-34(42-16-10-6-2)36(44-18-12-8-4)35(43-17-11-7-3)33(45-30)26-20-25(27(37)22-28(26)39)21-32-38-23-31(46-32)29-14-13-19-41-29/h13-14,19-20,22-23,30,33-36,39H,5-12,15-18,21,24H2,1-4H3/t30-,33+,34-,35?,36+/m1/s1 |
| InChIKey | LHRKSLHTAUCIQJ-KTOBCJQNSA-N |
| XLogP | 9.17 |
| TPSA | 92.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.33 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|