C37H56BrClO6 — CID 89283894
2-bromo-3-chloro-4-[(4-ethylphenyl)methyl]-6-[(3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]phenol (PubChem CID 89283894) has the molecular formula C37H56BrClO6 and a molecular weight of 712.21 g/mol. Its IUPAC name is 2-bromo-3-chloro-4-[(4-ethylphenyl)methyl]-6-[(3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]phenol.
| Compound Name | 2-bromo-3-chloro-4-[(4-ethylphenyl)methyl]-6-[(3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]phenol |
|---|---|
| PubChem CID | 89283894 |
| Molecular Formula | C37H56BrClO6 |
| Molecular Weight | 712.21 g/mol |
| Exact Mass | 710.29 |
| IUPAC Name | 2-bromo-3-chloro-4-[(4-ethylphenyl)methyl]-6-[(3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]phenol |
| SMILES | CCCCOC[C@H]1OC(c2cc(Cc3ccc(CC)cc3)c(Cl)c(Br)c2O)C(OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C37H56BrClO6/c1-6-11-19-41-25-30-35(42-20-12-7-2)37(44-22-14-9-4)36(43-21-13-8-3)34(45-30)29-24-28(32(39)31(38)33(29)40)23-27-17-15-26(10-5)16-18-27/h15-18,24,30,34-37,40H,6-14,19-23,25H2,1-5H3/t30-,34?,35-,36?,37+/m1/s1 |
| InChIKey | SLNOPDVJMQLRPA-UXRBMUFWSA-N |
| XLogP | 9.77 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.21 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|