C35H54Cl2N2O5 — CID 88944959
2,6-dichloro-3-[(4-ethylphenyl)methyl]-5-[(3S,5R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]pyrazine (PubChem CID 88944959) has the molecular formula C35H54Cl2N2O5 and a molecular weight of 653.73 g/mol. Its IUPAC name is 2,6-dichloro-3-[(4-ethylphenyl)methyl]-5-[(3S,5R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]pyrazine.
| Compound Name | 2,6-dichloro-3-[(4-ethylphenyl)methyl]-5-[(3S,5R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]pyrazine |
|---|---|
| PubChem CID | 88944959 |
| Molecular Formula | C35H54Cl2N2O5 |
| Molecular Weight | 653.73 g/mol |
| Exact Mass | 652.34 |
| IUPAC Name | 2,6-dichloro-3-[(4-ethylphenyl)methyl]-5-[(3S,5R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]pyrazine |
| SMILES | CCCCOCC1OC(c2nc(Cc3ccc(CC)cc3)c(Cl)nc2Cl)C(OCCCC)C(OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C35H54Cl2N2O5/c1-6-11-19-40-24-28-30(41-20-12-7-2)32(42-21-13-8-3)33(43-22-14-9-4)31(44-28)29-35(37)39-34(36)27(38-29)23-26-17-15-25(10-5)16-18-26/h15-18,28,30-33H,6-14,19-24H2,1-5H3/t28?,30-,31?,32?,33?/m1/s1 |
| InChIKey | IJGVDVZHFWMSDK-PTOPHONWSA-N |
| XLogP | 8.75 |
| TPSA | 71.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.73 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|