C39H56O8S — CID 71199724
2-[4-(1-benzothiophen-2-ylmethyl)-2-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]phenoxy]acetic acid (PubChem CID 71199724) has the molecular formula C39H56O8S and a molecular weight of 684.94 g/mol. Its IUPAC name is 2-[4-(1-benzothiophen-2-ylmethyl)-2-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]phenoxy]acetic acid.
| Compound Name | 2-[4-(1-benzothiophen-2-ylmethyl)-2-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 71199724 |
| Molecular Formula | C39H56O8S |
| Molecular Weight | 684.94 g/mol |
| Exact Mass | 684.37 |
| IUPAC Name | 2-[4-(1-benzothiophen-2-ylmethyl)-2-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]phenoxy]acetic acid |
| SMILES | CCCCOC[C@H]1O[C@@H](c2cc(Cc3cc4ccccc4s3)ccc2OCC(=O)O)[C@H](OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C39H56O8S/c1-5-9-19-42-26-33-37(43-20-10-6-2)39(45-22-12-8-4)38(44-21-11-7-3)36(47-33)31-24-28(17-18-32(31)46-27-35(40)41)23-30-25-29-15-13-14-16-34(29)48-30/h13-18,24-25,33,36-39H,5-12,19-23,26-27H2,1-4H3,(H,40,41)/t33-,36+,37-,38+,39+/m1/s1 |
| InChIKey | YPFBADUHNNUIIY-QQYMBSMASA-N |
| XLogP | 8.77 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.94 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|