C51H48O8S — CID 67187031
2-[4-(1-benzothiophen-2-ylmethyl)-2-[(2S,3S,4R,5R,6R)-3,4,5-tribenzyl-3,4,5-trihydroxy-6-(1-hydroxy-2-phenylethyl)oxan-2-yl]phenoxy]acetic acid (PubChem CID 67187031) has the molecular formula C51H48O8S and a molecular weight of 821.00 g/mol. Its IUPAC name is 2-[4-(1-benzothiophen-2-ylmethyl)-2-[(2S,3S,4R,5R,6R)-3,4,5-tribenzyl-3,4,5-trihydroxy-6-(1-hydroxy-2-phenylethyl)oxan-2-yl]phenoxy]acetic acid.
| Compound Name | 2-[4-(1-benzothiophen-2-ylmethyl)-2-[(2S,3S,4R,5R,6R)-3,4,5-tribenzyl-3,4,5-trihydroxy-6-(1-hydroxy-2-phenylethyl)oxan-2-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 67187031 |
| Molecular Formula | C51H48O8S |
| Molecular Weight | 821.00 g/mol |
| Exact Mass | 820.31 |
| IUPAC Name | 2-[4-(1-benzothiophen-2-ylmethyl)-2-[(2S,3S,4R,5R,6R)-3,4,5-tribenzyl-3,4,5-trihydroxy-6-(1-hydroxy-2-phenylethyl)oxan-2-yl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(Cc2cc3ccccc3s2)cc1[C@@H]1O[C@H](C(O)Cc2ccccc2)[C@](O)(Cc2ccccc2)[C@@](O)(Cc2ccccc2)[C@]1(O)Cc1ccccc1 |
| InChI | InChI=1S/C51H48O8S/c52-43(29-35-15-5-1-6-16-35)48-50(56,32-37-19-9-3-10-20-37)51(57,33-38-21-11-4-12-22-38)49(55,31-36-17-7-2-8-18-36)47(59-48)42-28-39(25-26-44(42)58-34-46(53)54)27-41-30-40-23-13-14-24-45(40)60-41/h1-26,28,30,43,47-48,52,55-57H,27,29,31-34H2,(H,53,54)/t43?,47-,48+,49-,50+,51+/m0/s1 |
| InChIKey | YCRHOXHEPSYIRS-RMKZJXSBSA-N |
| XLogP | 7.92 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.00 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |