C54H55NO7S — CID 58843540
tert-butyl N-[4-(1-benzothiophen-2-ylmethyl)-2-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]carbamate (PubChem CID 58843540) has the molecular formula C54H55NO7S and a molecular weight of 862.10 g/mol. Its IUPAC name is tert-butyl N-[4-(1-benzothiophen-2-ylmethyl)-2-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-(1-benzothiophen-2-ylmethyl)-2-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 58843540 |
| Molecular Formula | C54H55NO7S |
| Molecular Weight | 862.10 g/mol |
| Exact Mass | 861.37 |
| IUPAC Name | tert-butyl N-[4-(1-benzothiophen-2-ylmethyl)-2-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(Cc2cc3ccccc3s2)cc1[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C54H55NO7S/c1-54(2,3)62-53(56)55-46-29-28-42(30-44-32-43-26-16-17-27-48(43)63-44)31-45(46)49-51(59-35-40-22-12-6-13-23-40)52(60-36-41-24-14-7-15-25-41)50(58-34-39-20-10-5-11-21-39)47(61-49)37-57-33-38-18-8-4-9-19-38/h4-29,31-32,47,49-52H,30,33-37H2,1-3H3,(H,55,56)/t47-,49+,50-,51+,52+/m1/s1 |
| InChIKey | BFQDASFPQATUQJ-YFSBCMQPSA-N |
| XLogP | 12.25 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.10 |
| LogP ≤ 5 | 12.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |