C55H52O5S — CID 67156415
(2R,3S,4R,5R)-2-[3-[(5-ethyl-1-benzothiophen-2-yl)methyl]naphthalen-1-yl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 67156415) has the molecular formula C55H52O5S and a molecular weight of 825.08 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-[3-[(5-ethyl-1-benzothiophen-2-yl)methyl]naphthalen-1-yl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2R,3S,4R,5R)-2-[3-[(5-ethyl-1-benzothiophen-2-yl)methyl]naphthalen-1-yl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 67156415 |
| Molecular Formula | C55H52O5S |
| Molecular Weight | 825.08 g/mol |
| Exact Mass | 824.35 |
| IUPAC Name | (2R,3S,4R,5R)-2-[3-[(5-ethyl-1-benzothiophen-2-yl)methyl]naphthalen-1-yl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | CCc1ccc2sc(Cc3cc([C@H]4OC(COCc5ccccc5)[C@@H](OCc5ccccc5)[C@H](OCc5ccccc5)[C@H]4OCc4ccccc4)c4ccccc4c3)cc2c1 |
| InChI | InChI=1S/C55H52O5S/c1-2-39-27-28-51-46(29-39)33-47(61-51)31-44-30-45-25-15-16-26-48(45)49(32-44)52-54(58-36-42-21-11-5-12-22-42)55(59-37-43-23-13-6-14-24-43)53(57-35-41-19-9-4-10-20-41)50(60-52)38-56-34-40-17-7-3-8-18-40/h3-30,32-33,50,52-55H,2,31,34-38H2,1H3/t50?,52-,53-,54+,55+/m1/s1 |
| InChIKey | NOTBRYLCDCFKEQ-XRKUVYDUSA-N |
| XLogP | 12.62 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.08 |
| LogP ≤ 5 | 12.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |