C40H60O8S — CID 89233862
(2S,3S,5R,6R)-2-[5-(1-benzothiophen-2-ylmethyl)-2-(2-methylperoxyethoxy)phenyl]-3,4,5-tributoxy-6-(butoxymethyl)oxane (PubChem CID 89233862) has the molecular formula C40H60O8S and a molecular weight of 700.98 g/mol. Its IUPAC name is (2S,3S,5R,6R)-2-[5-(1-benzothiophen-2-ylmethyl)-2-(2-methylperoxyethoxy)phenyl]-3,4,5-tributoxy-6-(butoxymethyl)oxane.
| Compound Name | (2S,3S,5R,6R)-2-[5-(1-benzothiophen-2-ylmethyl)-2-(2-methylperoxyethoxy)phenyl]-3,4,5-tributoxy-6-(butoxymethyl)oxane |
|---|---|
| PubChem CID | 89233862 |
| Molecular Formula | C40H60O8S |
| Molecular Weight | 700.98 g/mol |
| Exact Mass | 700.40 |
| IUPAC Name | (2S,3S,5R,6R)-2-[5-(1-benzothiophen-2-ylmethyl)-2-(2-methylperoxyethoxy)phenyl]-3,4,5-tributoxy-6-(butoxymethyl)oxane |
| SMILES | CCCCOC[C@H]1O[C@@H](c2cc(Cc3cc4ccccc4s3)ccc2OCCOOC)[C@H](OCCCC)C(OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C40H60O8S/c1-6-10-20-42-29-35-38(44-21-11-7-2)40(46-23-13-9-4)39(45-22-12-8-3)37(48-35)33-27-30(18-19-34(33)43-24-25-47-41-5)26-32-28-31-16-14-15-17-36(31)49-32/h14-19,27-28,35,37-40H,6-13,20-26,29H2,1-5H3/t35-,37+,38-,39+,40?/m1/s1 |
| InChIKey | KGNLSGMGVIOPSA-VTSAKEHISA-N |
| XLogP | 9.26 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.98 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|