C39H60O7S — CID 88944954
(2R,3R,5S)-3,4,5-tributoxy-2-(butoxymethyl)-6-[5-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-2-(methylperoxymethyl)phenyl]oxane (PubChem CID 88944954) has the molecular formula C39H60O7S and a molecular weight of 672.97 g/mol. Its IUPAC name is (2R,3R,5S)-3,4,5-tributoxy-2-(butoxymethyl)-6-[5-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-2-(methylperoxymethyl)phenyl]oxane.
| Compound Name | (2R,3R,5S)-3,4,5-tributoxy-2-(butoxymethyl)-6-[5-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-2-(methylperoxymethyl)phenyl]oxane |
|---|---|
| PubChem CID | 88944954 |
| Molecular Formula | C39H60O7S |
| Molecular Weight | 672.97 g/mol |
| Exact Mass | 672.41 |
| IUPAC Name | (2R,3R,5S)-3,4,5-tributoxy-2-(butoxymethyl)-6-[5-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-2-(methylperoxymethyl)phenyl]oxane |
| SMILES | CCCCOC[C@H]1OC(c2cc(CC3Cc4ccccc4S3)ccc2COOC)[C@H](OCCCC)C(OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C39H60O7S/c1-6-10-20-41-28-34-37(42-21-11-7-2)39(44-23-13-9-4)38(43-22-12-8-3)36(46-34)33-25-29(18-19-31(33)27-45-40-5)24-32-26-30-16-14-15-17-35(30)47-32/h14-19,25,32,34,36-39H,6-13,20-24,26-28H2,1-5H3/t32?,34-,36?,37-,38+,39?/m1/s1 |
| InChIKey | KUFMOEAHAIPHFG-YOGNQLJXSA-N |
| XLogP | 8.84 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.97 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|