C40H64O7S — CID 71057540
2-[4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-1-methyl-6-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]cyclohexa-2,4-dien-1-yl]oxyethanol (PubChem CID 71057540) has the molecular formula C40H64O7S and a molecular weight of 689.01 g/mol. Its IUPAC name is 2-[4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-1-methyl-6-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]cyclohexa-2,4-dien-1-yl]oxyethanol.
| Compound Name | 2-[4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-1-methyl-6-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]cyclohexa-2,4-dien-1-yl]oxyethanol |
|---|---|
| PubChem CID | 71057540 |
| Molecular Formula | C40H64O7S |
| Molecular Weight | 689.01 g/mol |
| Exact Mass | 688.44 |
| IUPAC Name | 2-[4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-1-methyl-6-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]cyclohexa-2,4-dien-1-yl]oxyethanol |
| SMILES | CCCCOC[C@H]1O[C@@H](C2C=C(CC3Cc4ccccc4S3)C=CC2(C)OCCO)[C@H](OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C40H64O7S/c1-6-10-21-42-29-34-37(43-22-11-7-2)39(45-24-13-9-4)38(44-23-12-8-3)36(47-34)33-27-30(18-19-40(33,5)46-25-20-41)26-32-28-31-16-14-15-17-35(31)48-32/h14-19,27,32-34,36-39,41H,6-13,20-26,28-29H2,1-5H3/t32?,33?,34-,36+,37-,38+,39+,40?/m1/s1 |
| InChIKey | NBCYVFDVNPGMFY-RBDFTIBASA-N |
| XLogP | 8.11 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.01 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|