C23H45FO5 — CID 71157142
(2R,3S,4S,5R,6R)-3,4,5-tributoxy-2-(butoxymethyl)-6-(fluoromethyl)oxane (PubChem CID 71157142) has the molecular formula C23H45FO5 and a molecular weight of 420.61 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-3,4,5-tributoxy-2-(butoxymethyl)-6-(fluoromethyl)oxane.
| Compound Name | (2R,3S,4S,5R,6R)-3,4,5-tributoxy-2-(butoxymethyl)-6-(fluoromethyl)oxane |
|---|---|
| PubChem CID | 71157142 |
| Molecular Formula | C23H45FO5 |
| Molecular Weight | 420.61 g/mol |
| Exact Mass | 420.33 |
| IUPAC Name | (2R,3S,4S,5R,6R)-3,4,5-tributoxy-2-(butoxymethyl)-6-(fluoromethyl)oxane |
| SMILES | CCCCOC[C@H]1O[C@@H](CF)[C@H](OCCCC)[C@@H](OCCCC)[C@H]1OCCCC |
| InChI | InChI=1S/C23H45FO5/c1-5-9-13-25-18-20-22(27-15-11-7-3)23(28-16-12-8-4)21(19(17-24)29-20)26-14-10-6-2/h19-23H,5-18H2,1-4H3/t19-,20+,21-,22-,23+/m0/s1 |
| InChIKey | CXFJQPMURSOPDI-MFKCLSPESA-N |
| XLogP | 5.10 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.61 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|