C20H40O7 — CID 71171695
(2R,3R,4S,5R,6R,7R)-5,6-dibutoxy-7-(butoxymethyl)-2-methoxyoxepane-3,4-diol (PubChem CID 71171695) has the molecular formula C20H40O7 and a molecular weight of 392.53 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R,7R)-5,6-dibutoxy-7-(butoxymethyl)-2-methoxyoxepane-3,4-diol.
| Compound Name | (2R,3R,4S,5R,6R,7R)-5,6-dibutoxy-7-(butoxymethyl)-2-methoxyoxepane-3,4-diol |
|---|---|
| PubChem CID | 71171695 |
| Molecular Formula | C20H40O7 |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.28 |
| IUPAC Name | (2R,3R,4S,5R,6R,7R)-5,6-dibutoxy-7-(butoxymethyl)-2-methoxyoxepane-3,4-diol |
| SMILES | CCCCOC[C@H]1O[C@@H](OC)[C@H](O)[C@H](O)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C20H40O7/c1-5-8-11-24-14-15-18(25-12-9-6-2)19(26-13-10-7-3)16(21)17(22)20(23-4)27-15/h15-22H,5-14H2,1-4H3/t15-,16+,17-,18-,19-,20-/m1/s1 |
| InChIKey | CQNKVGFGWAGBMF-DNDRQTMDSA-N |
| XLogP | 2.27 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|