C12H24O8S — CID 164772763
4-[(4,5-dihydroxy-3,6-dimethoxyoxan-2-yl)methoxy]butane-1-sulfinic acid (PubChem CID 164772763) has the molecular formula C12H24O8S and a molecular weight of 328.38 g/mol. Its IUPAC name is 4-[(4,5-dihydroxy-3,6-dimethoxyoxan-2-yl)methoxy]butane-1-sulfinic acid.
| Compound Name | 4-[(4,5-dihydroxy-3,6-dimethoxyoxan-2-yl)methoxy]butane-1-sulfinic acid |
|---|---|
| PubChem CID | 164772763 |
| Molecular Formula | C12H24O8S |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 4-[(4,5-dihydroxy-3,6-dimethoxyoxan-2-yl)methoxy]butane-1-sulfinic acid |
| SMILES | COC1OC(COCCCCS(=O)O)C(OC)C(O)C1O |
| InChI | InChI=1S/C12H24O8S/c1-17-11-8(7-19-5-3-4-6-21(15)16)20-12(18-2)10(14)9(11)13/h8-14H,3-7H2,1-2H3,(H,15,16) |
| InChIKey | SEZNBKPADKBWIP-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|