C10H24O6 — CID 163618143
6-(hydroxymethyl)-2,5-dimethoxyoxane-3,4-diol;methane (PubChem CID 163618143) has the molecular formula C10H24O6 and a molecular weight of 240.30 g/mol. Its IUPAC name is 6-(hydroxymethyl)-2,5-dimethoxyoxane-3,4-diol;methane.
| Compound Name | 6-(hydroxymethyl)-2,5-dimethoxyoxane-3,4-diol;methane |
|---|---|
| PubChem CID | 163618143 |
| Molecular Formula | C10H24O6 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 6-(hydroxymethyl)-2,5-dimethoxyoxane-3,4-diol;methane |
| SMILES | C.C.COC1OC(CO)C(OC)C(O)C1O |
| InChI | InChI=1S/C8H16O6.2CH4/c1-12-7-4(3-9)14-8(13-2)6(11)5(7)10;;/h4-11H,3H2,1-2H3;2*1H4 |
| InChIKey | HLTDBIRVTFQBLB-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |