C8H16O6 — CID 153463753
(2R,4S,5S)-6-(hydroxymethyl)-2,5-dimethoxyoxane-3,4-diol (PubChem CID 153463753) has the molecular formula C8H16O6 and a molecular weight of 208.21 g/mol. Its IUPAC name is (2R,4S,5S)-6-(hydroxymethyl)-2,5-dimethoxyoxane-3,4-diol.
| Compound Name | (2R,4S,5S)-6-(hydroxymethyl)-2,5-dimethoxyoxane-3,4-diol |
|---|---|
| PubChem CID | 153463753 |
| Molecular Formula | C8H16O6 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | (2R,4S,5S)-6-(hydroxymethyl)-2,5-dimethoxyoxane-3,4-diol |
| SMILES | CO[C@@H]1OC(CO)[C@@H](OC)[C@@H](O)C1O |
| InChI | InChI=1S/C8H16O6/c1-12-7-4(3-9)14-8(13-2)6(11)5(7)10/h4-11H,3H2,1-2H3/t4?,5-,6?,7+,8+/m0/s1 |
| InChIKey | YEEFEWNECFNTEE-SHIRPBDBSA-N |
| XLogP | -1.91 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |