C7H15O6P — CID 159542010
6-(hydroxymethyl)-5-methoxy-2-phosphanyloxyoxane-3,4-diol (PubChem CID 159542010) has the molecular formula C7H15O6P and a molecular weight of 226.16 g/mol. Its IUPAC name is 6-(hydroxymethyl)-5-methoxy-2-phosphanyloxyoxane-3,4-diol.
| Compound Name | 6-(hydroxymethyl)-5-methoxy-2-phosphanyloxyoxane-3,4-diol |
|---|---|
| PubChem CID | 159542010 |
| Molecular Formula | C7H15O6P |
| Molecular Weight | 226.16 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 6-(hydroxymethyl)-5-methoxy-2-phosphanyloxyoxane-3,4-diol |
| SMILES | COC1C(CO)OC(OP)C(O)C1O |
| InChI | InChI=1S/C7H15O6P/c1-11-6-3(2-8)12-7(13-14)5(10)4(6)9/h3-10H,2,14H2,1H3 |
| InChIKey | MEIHVVRBIXHQMB-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.16 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|