C8H16O6 — CID 58090235
(3R,4R,5R)-6-(hydroxymethyl)-2,5-dimethoxyoxane-3,4-diol (PubChem CID 58090235) has the molecular formula C8H16O6 and a molecular weight of 208.21 g/mol. Its IUPAC name is (3R,4R,5R)-6-(hydroxymethyl)-2,5-dimethoxyoxane-3,4-diol.
| Compound Name | (3R,4R,5R)-6-(hydroxymethyl)-2,5-dimethoxyoxane-3,4-diol |
|---|---|
| PubChem CID | 58090235 |
| Molecular Formula | C8H16O6 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | (3R,4R,5R)-6-(hydroxymethyl)-2,5-dimethoxyoxane-3,4-diol |
| SMILES | COC1OC(CO)[C@H](OC)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C8H16O6/c1-12-7-4(3-9)14-8(13-2)6(11)5(7)10/h4-11H,3H2,1-2H3/t4?,5-,6-,7+,8?/m1/s1 |
| InChIKey | YEEFEWNECFNTEE-HTZDBOMISA-N |
| XLogP | -1.91 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |