C9H18O6 — CID 54407177
(2R,3R,4R,5S,6R)-6-(hydroxymethyl)-2,4,5-trimethoxyoxan-3-ol (PubChem CID 54407177) has the molecular formula C9H18O6 and a molecular weight of 222.24 g/mol. Its IUPAC name is (2R,3R,4R,5S,6R)-6-(hydroxymethyl)-2,4,5-trimethoxyoxan-3-ol.
| Compound Name | (2R,3R,4R,5S,6R)-6-(hydroxymethyl)-2,4,5-trimethoxyoxan-3-ol |
|---|---|
| PubChem CID | 54407177 |
| Molecular Formula | C9H18O6 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | (2R,3R,4R,5S,6R)-6-(hydroxymethyl)-2,4,5-trimethoxyoxan-3-ol |
| SMILES | CO[C@@H]1O[C@H](CO)[C@H](OC)[C@H](OC)[C@H]1O |
| InChI | InChI=1S/C9H18O6/c1-12-7-5(4-10)15-9(14-3)6(11)8(7)13-2/h5-11H,4H2,1-3H3/t5-,6-,7+,8-,9-/m1/s1 |
| InChIKey | VRNUDRWCZNJISG-SYHAXYEDSA-N |
| XLogP | -1.26 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |