C8H15BrO5 — CID 123587223
6-(bromomethyl)-2,5-dimethoxyoxane-3,4-diol (PubChem CID 123587223) has the molecular formula C8H15BrO5 and a molecular weight of 271.11 g/mol. Its IUPAC name is 6-(bromomethyl)-2,5-dimethoxyoxane-3,4-diol.
| Compound Name | 6-(bromomethyl)-2,5-dimethoxyoxane-3,4-diol |
|---|---|
| PubChem CID | 123587223 |
| Molecular Formula | C8H15BrO5 |
| Molecular Weight | 271.11 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | 6-(bromomethyl)-2,5-dimethoxyoxane-3,4-diol |
| SMILES | COC1OC(CBr)C(OC)C(O)C1O |
| InChI | InChI=1S/C8H15BrO5/c1-12-7-4(3-9)14-8(13-2)6(11)5(7)10/h4-8,10-11H,3H2,1-2H3 |
| InChIKey | CVRZBPBYZXTPHV-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.11 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|