C5H10O5 — CID 122494930
5-methoxyoxolane-2,3,4-triol (PubChem CID 122494930) has the molecular formula C5H10O5 and a molecular weight of 150.13 g/mol. Its IUPAC name is 5-methoxyoxolane-2,3,4-triol.
| Compound Name | 5-methoxyoxolane-2,3,4-triol |
|---|---|
| PubChem CID | 122494930 |
| Molecular Formula | C5H10O5 |
| Molecular Weight | 150.13 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | 5-methoxyoxolane-2,3,4-triol |
| SMILES | COC1OC(O)C(O)C1O |
| InChI | InChI=1S/C5H10O5/c1-9-5-3(7)2(6)4(8)10-5/h2-8H,1H3 |
| InChIKey | DJJLGKRRMJASPY-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.13 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |