C6H12O5 — CID 99945935
(2S,3R,4R,5S)-2,5-dimethoxyoxolane-3,4-diol (PubChem CID 99945935) has the molecular formula C6H12O5 and a molecular weight of 164.16 g/mol. Its IUPAC name is (2S,3R,4R,5S)-2,5-dimethoxyoxolane-3,4-diol.
| Compound Name | (2S,3R,4R,5S)-2,5-dimethoxyoxolane-3,4-diol |
|---|---|
| PubChem CID | 99945935 |
| Molecular Formula | C6H12O5 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | (2S,3R,4R,5S)-2,5-dimethoxyoxolane-3,4-diol |
| SMILES | CO[C@H]1O[C@H](OC)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C6H12O5/c1-9-5-3(7)4(8)6(10-2)11-5/h3-8H,1-2H3/t3-,4-,5+,6+/m1/s1 |
| InChIKey | WNGXQPRWPICLEF-ZXXMMSQZSA-N |
| XLogP | -1.32 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |