C10H19BrO5 — CID 14374457
(2S,3S,4S,5R,6S)-2-(bromomethyl)-3,4,5,6-tetramethoxyoxane (PubChem CID 14374457) has the molecular formula C10H19BrO5 and a molecular weight of 299.16 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-2-(bromomethyl)-3,4,5,6-tetramethoxyoxane.
| Compound Name | (2S,3S,4S,5R,6S)-2-(bromomethyl)-3,4,5,6-tetramethoxyoxane |
|---|---|
| PubChem CID | 14374457 |
| Molecular Formula | C10H19BrO5 |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | (2S,3S,4S,5R,6S)-2-(bromomethyl)-3,4,5,6-tetramethoxyoxane |
| SMILES | CO[C@H]1O[C@H](CBr)[C@@H](OC)[C@H](OC)[C@H]1OC |
| InChI | InChI=1S/C10H19BrO5/c1-12-7-6(5-11)16-10(15-4)9(14-3)8(7)13-2/h6-10H,5H2,1-4H3/t6-,7-,8+,9-,10+/m1/s1 |
| InChIKey | CFNXWCHJEYOQEO-SPFKKGSWSA-N |
| XLogP | 0.80 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|