C10H20O6 — CID 568209
2,3,4,5,6-pentamethoxyoxane (PubChem CID 568209) has the molecular formula C10H20O6 and a molecular weight of 236.26 g/mol. Its IUPAC name is 2,3,4,5,6-pentamethoxyoxane.
| Compound Name | 2,3,4,5,6-pentamethoxyoxane |
|---|---|
| PubChem CID | 568209 |
| Molecular Formula | C10H20O6 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 2,3,4,5,6-pentamethoxyoxane |
| SMILES | COC1OC(OC)C(OC)C(OC)C1OC |
| InChI | InChI=1S/C10H20O6/c1-11-6-7(12-2)9(14-4)16-10(15-5)8(6)13-3/h6-10H,1-5H3 |
| InChIKey | YZUSPMJJXMPNQW-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |