C13H26O7 — CID 560407
2-(1,2-dimethoxyethyl)-3,4,5,6-tetramethoxyoxane (PubChem CID 560407) has the molecular formula C13H26O7 and a molecular weight of 294.34 g/mol. Its IUPAC name is 2-(1,2-dimethoxyethyl)-3,4,5,6-tetramethoxyoxane.
| Compound Name | 2-(1,2-dimethoxyethyl)-3,4,5,6-tetramethoxyoxane |
|---|---|
| PubChem CID | 560407 |
| Molecular Formula | C13H26O7 |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 2-(1,2-dimethoxyethyl)-3,4,5,6-tetramethoxyoxane |
| SMILES | COCC(OC)C1OC(OC)C(OC)C(OC)C1OC |
| InChI | InChI=1S/C13H26O7/c1-14-7-8(15-2)9-10(16-3)11(17-4)12(18-5)13(19-6)20-9/h8-13H,7H2,1-6H3 |
| InChIKey | OAVQVPNWSSOVOK-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |