C23H44O11 — CID 509038
(3R,4R,5R)-2-(1,2-dihydroxyethyl)-5-[1-[(3S,4R,5R)-3,4-dimethoxy-5-octoxyoxolan-2-yl]-2-methoxyethoxy]oxolane-3,4-diol (PubChem CID 509038) has the molecular formula C23H44O11 and a molecular weight of 496.59 g/mol. Its IUPAC name is (3R,4R,5R)-2-(1,2-dihydroxyethyl)-5-[1-[(3S,4R,5R)-3,4-dimethoxy-5-octoxyoxolan-2-yl]-2-methoxyethoxy]oxolane-3,4-diol.
| Compound Name | (3R,4R,5R)-2-(1,2-dihydroxyethyl)-5-[1-[(3S,4R,5R)-3,4-dimethoxy-5-octoxyoxolan-2-yl]-2-methoxyethoxy]oxolane-3,4-diol |
|---|---|
| PubChem CID | 509038 |
| Molecular Formula | C23H44O11 |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.29 |
| IUPAC Name | (3R,4R,5R)-2-(1,2-dihydroxyethyl)-5-[1-[(3S,4R,5R)-3,4-dimethoxy-5-octoxyoxolan-2-yl]-2-methoxyethoxy]oxolane-3,4-diol |
| SMILES | CCCCCCCCO[C@@H]1OC(C(COC)O[C@@H]2OC(C(O)CO)[C@H](O)[C@H]2O)[C@H](OC)[C@H]1OC |
| InChI | InChI=1S/C23H44O11/c1-5-6-7-8-9-10-11-31-23-21(30-4)20(29-3)19(34-23)15(13-28-2)32-22-17(27)16(26)18(33-22)14(25)12-24/h14-27H,5-13H2,1-4H3/t14?,15?,16-,17-,18?,19?,20+,21-,22-,23-/m1/s1 |
| InChIKey | YLPDPSMIUUUGJS-LVOWUMRXSA-N |
| XLogP | -0.05 |
| TPSA | 145.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|