C21H34O6 — CID 15946241
(1R)-1-[(2S,3R,4S,5S)-3-hydroxy-5-octoxy-4-phenylmethoxyoxolan-2-yl]ethane-1,2-diol (PubChem CID 15946241) has the molecular formula C21H34O6 and a molecular weight of 382.50 g/mol. Its IUPAC name is (1R)-1-[(2S,3R,4S,5S)-3-hydroxy-5-octoxy-4-phenylmethoxyoxolan-2-yl]ethane-1,2-diol.
| Compound Name | (1R)-1-[(2S,3R,4S,5S)-3-hydroxy-5-octoxy-4-phenylmethoxyoxolan-2-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 15946241 |
| Molecular Formula | C21H34O6 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | (1R)-1-[(2S,3R,4S,5S)-3-hydroxy-5-octoxy-4-phenylmethoxyoxolan-2-yl]ethane-1,2-diol |
| SMILES | CCCCCCCCO[C@H]1O[C@@H]([C@H](O)CO)[C@@H](O)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C21H34O6/c1-2-3-4-5-6-10-13-25-21-20(18(24)19(27-21)17(23)14-22)26-15-16-11-8-7-9-12-16/h7-9,11-12,17-24H,2-6,10,13-15H2,1H3/t17-,18-,19+,20+,21+/m1/s1 |
| InChIKey | IVSYSXXEFCGZHL-MJCUULBUSA-N |
| XLogP | 2.39 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|