C36H48O5 — CID 102422537
(2R,3R,4S,5R)-2-decoxy-3,4,5-tris(phenylmethoxy)oxane (PubChem CID 102422537) has the molecular formula C36H48O5 and a molecular weight of 560.78 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-decoxy-3,4,5-tris(phenylmethoxy)oxane.
| Compound Name | (2R,3R,4S,5R)-2-decoxy-3,4,5-tris(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 102422537 |
| Molecular Formula | C36H48O5 |
| Molecular Weight | 560.78 g/mol |
| Exact Mass | 560.35 |
| IUPAC Name | (2R,3R,4S,5R)-2-decoxy-3,4,5-tris(phenylmethoxy)oxane |
| SMILES | CCCCCCCCCCO[C@@H]1OC[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C36H48O5/c1-2-3-4-5-6-7-8-18-25-37-36-35(40-28-32-23-16-11-17-24-32)34(39-27-31-21-14-10-15-22-31)33(29-41-36)38-26-30-19-12-9-13-20-30/h9-17,19-24,33-36H,2-8,18,25-29H2,1H3/t33-,34+,35-,36-/m1/s1 |
| InChIKey | MPTZSPURLPZOIG-IYKITFJXSA-N |
| XLogP | 8.26 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.78 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|