C19H20O4 — CID 25208780
(2R,3R,4S)-3,4-bis(phenylmethoxy)oxolane-2-carbaldehyde (PubChem CID 25208780) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is (2R,3R,4S)-3,4-bis(phenylmethoxy)oxolane-2-carbaldehyde.
| Compound Name | (2R,3R,4S)-3,4-bis(phenylmethoxy)oxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 25208780 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | (2R,3R,4S)-3,4-bis(phenylmethoxy)oxolane-2-carbaldehyde |
| SMILES | O=C[C@@H]1OC[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C19H20O4/c20-11-17-19(23-13-16-9-5-2-6-10-16)18(14-22-17)21-12-15-7-3-1-4-8-15/h1-11,17-19H,12-14H2/t17-,18-,19-/m0/s1 |
| InChIKey | GFBMZPKFVWCXIA-FHWLQOOXSA-N |
| XLogP | 2.75 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|