C26H28O4 — CID 122363520
(2R,3R,4S)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxolane (PubChem CID 122363520) has the molecular formula C26H28O4 and a molecular weight of 404.51 g/mol. Its IUPAC name is (2R,3R,4S)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxolane.
| Compound Name | (2R,3R,4S)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxolane |
|---|---|
| PubChem CID | 122363520 |
| Molecular Formula | C26H28O4 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | (2R,3R,4S)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxolane |
| SMILES | c1ccc(COC[C@H]2OC[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H28O4/c1-4-10-21(11-5-1)16-27-19-24-26(30-18-23-14-8-3-9-15-23)25(20-29-24)28-17-22-12-6-2-7-13-22/h1-15,24-26H,16-20H2/t24-,25+,26+/m1/s1 |
| InChIKey | VDBGWYUQYQZWMF-ZNZIZOMTSA-N |
| XLogP | 4.77 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |