C28H31NO6 — CID 166681867
[(3S,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]carbamic acid (PubChem CID 166681867) has the molecular formula C28H31NO6 and a molecular weight of 477.56 g/mol. Its IUPAC name is [(3S,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]carbamic acid.
| Compound Name | [(3S,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 166681867 |
| Molecular Formula | C28H31NO6 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | [(3S,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]carbamic acid |
| SMILES | O=C(O)N[C@H]1CO[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C28H31NO6/c30-28(31)29-24-19-33-25(20-32-16-21-10-4-1-5-11-21)27(35-18-23-14-8-3-9-15-23)26(24)34-17-22-12-6-2-7-13-22/h1-15,24-27,29H,16-20H2,(H,30,31)/t24-,25+,26+,27-/m0/s1 |
| InChIKey | WFXGVZCTGKGHIN-YAOOYPAMSA-N |
| XLogP | 4.41 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |