C22H26NO8S- — CID 140519564
[(3R,4S)-5-acetamido-3,4-bis(phenylmethoxy)oxan-2-yl]methyl sulfate (PubChem CID 140519564) has the molecular formula C22H26NO8S- and a molecular weight of 464.52 g/mol. Its IUPAC name is [(3R,4S)-5-acetamido-3,4-bis(phenylmethoxy)oxan-2-yl]methyl sulfate.
| Compound Name | [(3R,4S)-5-acetamido-3,4-bis(phenylmethoxy)oxan-2-yl]methyl sulfate |
|---|---|
| PubChem CID | 140519564 |
| Molecular Formula | C22H26NO8S- |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | [(3R,4S)-5-acetamido-3,4-bis(phenylmethoxy)oxan-2-yl]methyl sulfate |
| SMILES | CC(=O)NC1COC(COS(=O)(=O)[O-])[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C22H27NO8S/c1-16(24)23-19-14-28-20(15-31-32(25,26)27)22(30-13-18-10-6-3-7-11-18)21(19)29-12-17-8-4-2-5-9-17/h2-11,19-22H,12-15H2,1H3,(H,23,24)(H,25,26,27)/p-1/t19?,20?,21-,22-/m0/s1 |
| InChIKey | MVSGXDXQLYRNRJ-UJKMTWAASA-M |
| XLogP | 1.54 |
| TPSA | 123.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|