C16H23NO7S — CID 87102883
[(3S,4R)-5-acetamido-3-methyl-4-phenylmethoxyoxan-2-yl]methyl hydrogen sulfate (PubChem CID 87102883) has the molecular formula C16H23NO7S and a molecular weight of 373.43 g/mol. Its IUPAC name is [(3S,4R)-5-acetamido-3-methyl-4-phenylmethoxyoxan-2-yl]methyl hydrogen sulfate.
| Compound Name | [(3S,4R)-5-acetamido-3-methyl-4-phenylmethoxyoxan-2-yl]methyl hydrogen sulfate |
|---|---|
| PubChem CID | 87102883 |
| Molecular Formula | C16H23NO7S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | [(3S,4R)-5-acetamido-3-methyl-4-phenylmethoxyoxan-2-yl]methyl hydrogen sulfate |
| SMILES | CC(=O)NC1COC(COS(=O)(=O)O)[C@@H](C)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C16H23NO7S/c1-11-15(10-24-25(19,20)21)22-9-14(17-12(2)18)16(11)23-8-13-6-4-3-5-7-13/h3-7,11,14-16H,8-10H2,1-2H3,(H,17,18)(H,19,20,21)/t11-,14?,15?,16-/m1/s1 |
| InChIKey | QVHWIJPMGNOBEZ-JGVXXWTJSA-N |
| XLogP | 0.93 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|