C16H22O4 — CID 174153806
(3R,4S,5S,6R)-6-ethyl-5-methyl-4-phenylmethoxyoxane-3-carboxylic acid (PubChem CID 174153806) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is (3R,4S,5S,6R)-6-ethyl-5-methyl-4-phenylmethoxyoxane-3-carboxylic acid.
| Compound Name | (3R,4S,5S,6R)-6-ethyl-5-methyl-4-phenylmethoxyoxane-3-carboxylic acid |
|---|---|
| PubChem CID | 174153806 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (3R,4S,5S,6R)-6-ethyl-5-methyl-4-phenylmethoxyoxane-3-carboxylic acid |
| SMILES | CC[C@H]1OC[C@@H](C(=O)O)[C@@H](OCc2ccccc2)[C@H]1C |
| InChI | InChI=1S/C16H22O4/c1-3-14-11(2)15(13(10-19-14)16(17)18)20-9-12-7-5-4-6-8-12/h4-8,11,13-15H,3,9-10H2,1-2H3,(H,17,18)/t11-,13+,14+,15-/m0/s1 |
| InChIKey | IRAXFMCDGBNBJM-MYPMTAMASA-N |
| XLogP | 2.72 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |