C24H28O5 — CID 90441578
(2E)-2-[(3S,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-ylidene]acetic acid (PubChem CID 90441578) has the molecular formula C24H28O5 and a molecular weight of 396.48 g/mol. Its IUPAC name is (2E)-2-[(3S,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-ylidene]acetic acid.
| Compound Name | (2E)-2-[(3S,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-ylidene]acetic acid |
|---|---|
| PubChem CID | 90441578 |
| Molecular Formula | C24H28O5 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | (2E)-2-[(3S,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-ylidene]acetic acid |
| SMILES | CC[C@H]1O/C(=C/C(=O)O)[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)C1C |
| InChI | InChI=1S/C24H28O5/c1-3-20-17(2)23(27-15-18-10-6-4-7-11-18)24(21(29-20)14-22(25)26)28-16-19-12-8-5-9-13-19/h4-14,17,20,23-24H,3,15-16H2,1-2H3,(H,25,26)/b21-14+/t17?,20-,23+,24-/m1/s1 |
| InChIKey | DDXMSLRLHJKXHX-LQCGXWGQSA-N |
| XLogP | 4.57 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|