C45H52F2O7 — CID 123693532
(3R,4S,5R,6R)-2-(difluoromethylidene)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxane;(3R,4S,5S,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-one (PubChem CID 123693532) has the molecular formula C45H52F2O7 and a molecular weight of 742.90 g/mol. Its IUPAC name is (3R,4S,5R,6R)-2-(difluoromethylidene)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxane;(3R,4S,5S,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-one.
| Compound Name | (3R,4S,5R,6R)-2-(difluoromethylidene)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxane;(3R,4S,5S,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-one |
|---|---|
| PubChem CID | 123693532 |
| Molecular Formula | C45H52F2O7 |
| Molecular Weight | 742.90 g/mol |
| Exact Mass | 742.37 |
| IUPAC Name | (3R,4S,5R,6R)-2-(difluoromethylidene)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxane;(3R,4S,5S,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-one |
| SMILES | CC[C@H]1OC(=C(F)F)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)C1C.CC[C@H]1OC(=O)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1C |
| InChI | InChI=1S/C23H26F2O3.C22H26O4/c1-3-19-16(2)20(26-14-17-10-6-4-7-11-17)21(22(28-19)23(24)25)27-15-18-12-8-5-9-13-18;1-3-19-16(2)20(24-14-17-10-6-4-7-11-17)21(22(23)26-19)25-15-18-12-8-5-9-13-18/h4-13,16,19-21H,3,14-15H2,1-2H3;4-13,16,19-21H,3,14-15H2,1-2H3/t16?,19-,20+,21-;16-,19+,20-,21+/m10/s1 |
| InChIKey | GRRXDGKGQBVBTF-TVRXBZIJSA-N |
| XLogP | 9.84 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.90 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |