C23H28O4 — CID 134866923
(3R,4S,5S,6R)-3,5-dimethyl-4-phenylmethoxy-6-(2-phenylmethoxyethyl)oxan-2-one (PubChem CID 134866923) has the molecular formula C23H28O4 and a molecular weight of 368.47 g/mol. Its IUPAC name is (3R,4S,5S,6R)-3,5-dimethyl-4-phenylmethoxy-6-(2-phenylmethoxyethyl)oxan-2-one.
| Compound Name | (3R,4S,5S,6R)-3,5-dimethyl-4-phenylmethoxy-6-(2-phenylmethoxyethyl)oxan-2-one |
|---|---|
| PubChem CID | 134866923 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | (3R,4S,5S,6R)-3,5-dimethyl-4-phenylmethoxy-6-(2-phenylmethoxyethyl)oxan-2-one |
| SMILES | C[C@@H]1[C@H](OCc2ccccc2)[C@@H](C)C(=O)O[C@@H]1CCOCc1ccccc1 |
| InChI | InChI=1S/C23H28O4/c1-17-21(13-14-25-15-19-9-5-3-6-10-19)27-23(24)18(2)22(17)26-16-20-11-7-4-8-12-20/h3-12,17-18,21-22H,13-16H2,1-2H3/t17-,18+,21+,22-/m0/s1 |
| InChIKey | RWLYQGNWMORALD-KKXYHZGYSA-N |
| XLogP | 4.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|