C27H34O5 — CID 11604561
(3R,5S,7S,8R)-4,4,8-trimethyl-3-phenylmethoxy-7-(2-phenylmethoxyethyl)-1,6-dioxaspiro[4.5]decan-9-one (PubChem CID 11604561) has the molecular formula C27H34O5 and a molecular weight of 438.56 g/mol. Its IUPAC name is (3R,5S,7S,8R)-4,4,8-trimethyl-3-phenylmethoxy-7-(2-phenylmethoxyethyl)-1,6-dioxaspiro[4.5]decan-9-one.
| Compound Name | (3R,5S,7S,8R)-4,4,8-trimethyl-3-phenylmethoxy-7-(2-phenylmethoxyethyl)-1,6-dioxaspiro[4.5]decan-9-one |
|---|---|
| PubChem CID | 11604561 |
| Molecular Formula | C27H34O5 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | (3R,5S,7S,8R)-4,4,8-trimethyl-3-phenylmethoxy-7-(2-phenylmethoxyethyl)-1,6-dioxaspiro[4.5]decan-9-one |
| SMILES | C[C@H]1C(=O)C[C@]2(OC[C@H](OCc3ccccc3)C2(C)C)O[C@H]1CCOCc1ccccc1 |
| InChI | InChI=1S/C27H34O5/c1-20-23(28)16-27(32-24(20)14-15-29-17-21-10-6-4-7-11-21)26(2,3)25(19-31-27)30-18-22-12-8-5-9-13-22/h4-13,20,24-25H,14-19H2,1-3H3/t20-,24-,25-,27-/m0/s1 |
| InChIKey | UGFDUOJLVCEANY-DCBAMDGSSA-N |
| XLogP | 4.93 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|