C27H32O6 — CID 10671347
(2S,8S)-2,8-bis(2-phenylmethoxyethyl)-1,7-dioxaspiro[5.5]undecane-4,10-dione (PubChem CID 10671347) has the molecular formula C27H32O6 and a molecular weight of 452.55 g/mol. Its IUPAC name is (2S,8S)-2,8-bis(2-phenylmethoxyethyl)-1,7-dioxaspiro[5.5]undecane-4,10-dione.
| Compound Name | (2S,8S)-2,8-bis(2-phenylmethoxyethyl)-1,7-dioxaspiro[5.5]undecane-4,10-dione |
|---|---|
| PubChem CID | 10671347 |
| Molecular Formula | C27H32O6 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | (2S,8S)-2,8-bis(2-phenylmethoxyethyl)-1,7-dioxaspiro[5.5]undecane-4,10-dione |
| SMILES | O=C1C[C@H](CCOCc2ccccc2)OC2(C1)CC(=O)C[C@H](CCOCc1ccccc1)O2 |
| InChI | InChI=1S/C27H32O6/c28-23-15-25(11-13-30-19-21-7-3-1-4-8-21)32-27(17-23)18-24(29)16-26(33-27)12-14-31-20-22-9-5-2-6-10-22/h1-10,25-26H,11-20H2/t25-,26-,27?/m0/s1 |
| InChIKey | NGDAQYSAPJHYQJ-TXIPYEPDSA-N |
| XLogP | 4.39 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|