C15H18O3 — CID 11075746
2-(3-phenylmethoxypropyl)-2,3-dihydropyran-4-one (PubChem CID 11075746) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-(3-phenylmethoxypropyl)-2,3-dihydropyran-4-one.
| Compound Name | 2-(3-phenylmethoxypropyl)-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 11075746 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 2-(3-phenylmethoxypropyl)-2,3-dihydropyran-4-one |
| SMILES | O=C1C=COC(CCCOCc2ccccc2)C1 |
| InChI | InChI=1S/C15H18O3/c16-14-8-10-18-15(11-14)7-4-9-17-12-13-5-2-1-3-6-13/h1-3,5-6,8,10,15H,4,7,9,11-12H2 |
| InChIKey | YNKHHCNTBVZTDB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|