C20H30O4 — CID 101081018
(4S)-4-(10-phenylmethoxydecyl)-1,3-dioxolan-2-one (PubChem CID 101081018) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (4S)-4-(10-phenylmethoxydecyl)-1,3-dioxolan-2-one.
| Compound Name | (4S)-4-(10-phenylmethoxydecyl)-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 101081018 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (4S)-4-(10-phenylmethoxydecyl)-1,3-dioxolan-2-one |
| SMILES | O=C1OC[C@H](CCCCCCCCCCOCc2ccccc2)O1 |
| InChI | InChI=1S/C20H30O4/c21-20-23-17-19(24-20)14-10-5-3-1-2-4-6-11-15-22-16-18-12-8-7-9-13-18/h7-9,12-13,19H,1-6,10-11,14-17H2/t19-/m0/s1 |
| InChIKey | OGDUFMFIAYRAES-IBGZPJMESA-N |
| XLogP | 5.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|